EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H3NO2 |
| Net Charge | 0 |
| Average Mass | 145.117 |
| Monoisotopic Mass | 145.01638 |
| SMILES | N#CC#CC#C/C=C/C(=O)O |
| InChI | InChI=1S/C8H3NO2/c9-7-5-3-1-2-4-6-8(10)11/h4,6H,(H,10,11)/b6-4+ |
| InChIKey | DMGKNZBGIHCAMP-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-7-Cyanohept-2-en-4,6-diynoic acid (CHEBI:185077) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-7-cyanohept-2-en-4,6-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031004 | HMDB |
| 4938371 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:463-15-0 | ChemIDplus |