EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | C#CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-undecynoic acid (CHEBI:185054) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| undec-10-ynoic acid |
| Synonym | Source |
|---|---|
| YQ3683000 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030618 | LIPID MAPS |
| 28797 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:2777-65-3 | ChemIDplus |