EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4O2 |
| Net Charge | 0 |
| Average Mass | 132.118 |
| Monoisotopic Mass | 132.02113 |
| SMILES | CC#CC#CC#CC(=O)O |
| InChI | InChI=1S/C8H4O2/c1-2-3-4-5-6-7-8(9)10/h1H3,(H,9,10) |
| InChIKey | GYUOOLGIYHUJRP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Psathyrella (ncbitaxon:71729) | - | DOI (10.1039/p19730002785) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-Octatriynoic acid (CHEBI:185052) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Names |
|---|
| methyl octa-2,4,6-triynoate |
| octa-2,4,6-triynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 19632221 | ChemSpider |
| 57518738 | ChemSpider |
| HMDB0030967 | HMDB |
| LMFA01030961 | LIPID MAPS |