EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O4 |
| Net Charge | 0 |
| Average Mass | 132.115 |
| Monoisotopic Mass | 132.04226 |
| SMILES | CC(CO)C(=O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-3(2-6)4(7)5(8)9/h3,6H,2H2,1H3,(H,8,9) |
| InChIKey | VGRJIVGLOZEXGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AKOS006378692 (CHEBI:185047) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 4-hydroxy-3-methyl-2-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32990353 | ChemSpider |