EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | O=C(O)CCCCCCCC(O)C(O)C/C=C/CCCCCO |
| InChI | InChI=1S/C18H34O5/c19-15-11-7-2-1-4-8-12-16(20)17(21)13-9-5-3-6-10-14-18(22)23/h4,8,16-17,19-21H,1-3,5-7,9-15H2,(H,22,23)/b8-4+ |
| InChIKey | NFBTXRAFZLIQAU-XBXARRHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10,18-TriHOME(12) (CHEBI:185042) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-9,10,18-trihydroxyoctadec-12-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472303 | ChemSpider |
| LMFA02000222 | LIPID MAPS |