EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39N3O8 |
| Net Charge | 0 |
| Average Mass | 485.578 |
| Monoisotopic Mass | 485.27372 |
| SMILES | CCC(C)C1NC(=O)C(C(C)C)OC(=O)C(C(C)O)NC(=O)C(C)NC(=O)C(C(C)C)OC1=O |
| InChI | InChI=1S/C23H39N3O8/c1-9-12(6)15-22(31)33-17(10(2)3)20(29)24-13(7)19(28)26-16(14(8)27)23(32)34-18(11(4)5)21(30)25-15/h10-18,27H,9H2,1-8H3,(H,24,29)(H,25,30)(H,26,28) |
| InChIKey | ZZZCVVSDKFDQJU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(Butan-2-yl)-5,11,14-trihydroxy-9-(1-hydroxyethyl)-12-methyl-6,15-bis(propan-2-yl)-1,7-dioxa-4,10,13-triazacyclopentadeca-4,10,13-triene-2,8-dione (CHEBI:185013) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 3-butan-2-yl-9-(1-hydroxyethyl)-12-methyl-6,15-di(propan-2-yl)-1,7-dioxa-4,10,13-triazacyclopentadecane-2,5,8,11,14-pentone |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041421 | HMDB |
| 35015180 | ChemSpider |