EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O2 |
| Net Charge | 0 |
| Average Mass | 212.333 |
| Monoisotopic Mass | 212.17763 |
| SMILES | CCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C13H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h11-12H,2-10H2,1H3,(H,14,15)/b12-11+ |
| InChIKey | GQVYBECSNBLQJV-VAWYXSNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-n-decyl acrylic acid (CHEBI:184969) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-tridec-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445862 | ChemSpider |
| LMFA01030044 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:6969-16-0 | ChemIDplus |