EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N3O10S |
| Net Charge | 0 |
| Average Mass | 619.693 |
| Monoisotopic Mass | 619.21997 |
| SMILES | CC(C)C(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(O)c1c(O)cc(/C=C/c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C29H37N3O10S/c1-15(2)27(43-14-20(28(40)31-13-24(37)38)32-23(36)10-9-19(30)29(41)42)26(39)25-21(34)11-17(12-22(25)35)4-3-16-5-7-18(33)8-6-16/h3-8,11-12,15,19-20,26-27,33-35,39H,9-10,13-14,30H2,1-2H3,(H,31,40)(H,32,36)(H,37,38)(H,41,42)/b4-3+ |
| InChIKey | YBJHUZXWQHRPKG-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-[(1-{2,6-dihydroxy-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl}-1-hydroxy-3-methylbutan-2-yl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:184923) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-[1-[2,6-dihydroxy-4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]-1-hydroxy-3-methylbutan-2-yl]sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0129022 | HMDB |