EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38F6O2 |
| Net Charge | 0 |
| Average Mass | 520.598 |
| Monoisotopic Mass | 520.27760 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(O)(C(F)(F)F)C(F)(F)F)[C@@]1(C)CCC/C2=C\C=C1/C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C28H38F6O2/c1-17-8-12-22(35)16-21(17)11-10-20-6-5-15-25(4)23(13-14-24(20)25)18(2)7-9-19(3)26(36,27(29,30)31)28(32,33)34/h7,9-11,18-19,22-24,35-36H,1,5-6,8,12-16H2,2-4H3/b9-7+,20-10+,21-11+/t18-,19+,22+,23-,24+,25-/m1/s1 |
| InChIKey | WIHFNGKRMGPABR-SBFIBYMCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26,26,26,27,27,27-hexafluoro-25-hydroxyvitamin D2 (CHEBI:184891) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-7,7,7-triluoro-6-hydroxy-5-methyl-6-(triluoromethyl)hept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 113385463 | ChemSpider |
| LMST03010008 | LIPID MAPS |