EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O9 |
| Net Charge | 0 |
| Average Mass | 532.545 |
| Monoisotopic Mass | 532.17333 |
| SMILES | Oc1cccc(CC(O)C(c2ccc(O)cc2O)c2c(O)cc(O)c3c2OC(c2cccc(O)c2)C(O)C3)c1 |
| InChI | InChI=1S/C30H28O9/c31-17-5-1-3-15(9-17)10-24(36)27(20-8-7-19(33)12-22(20)34)28-25(37)14-23(35)21-13-26(38)29(39-30(21)28)16-4-2-6-18(32)11-16/h1-9,11-12,14,24,26-27,29,31-38H,10,13H2 |
| InChIKey | HLFVQMCHVONVLR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-[1-(2,4-dihydroxyphenyl)-2-hydroxy-3-(3-hydroxyphenyl)propyl]-2-(3-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol (CHEBI:184846) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 8-[1-(2,4-dihydroxyphenyl)-2-hydroxy-3-(3-hydroxyphenyl)propyl]-2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0135067 | HMDB |