EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O5 |
| Net Charge | 0 |
| Average Mass | 324.417 |
| Monoisotopic Mass | 324.19367 |
| SMILES | O=C(O)CCCCCCC/C=C\CC(=O)/C=C(O)/C=C\CCO |
| InChI | InChI=1S/C18H28O5/c19-14-10-9-12-17(21)15-16(20)11-7-5-3-1-2-4-6-8-13-18(22)23/h5,7,9,12,15,19,21H,1-4,6,8,10-11,13-14H2,(H,22,23)/b7-5-,12-9-,17-15- |
| InChIKey | LFTUCYCUYUJMJB-PBBFMNGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-14,18-dihydroxy-9Z,13E,15Z-octadecatrienoic acid (CHEBI:184845) is a octadecatrienoic acid (CHEBI:25633) |
| IUPAC Name |
|---|
| (9Z,13Z,15Z)-14,18-dihydroxy-12-oxooctadeca-9,13,15-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472339 | ChemSpider |
| LMFA01060126 | LIPID MAPS |