EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H70O14 |
| Net Charge | 0 |
| Average Mass | 811.019 |
| Monoisotopic Mass | 810.47656 |
| SMILES | COC1OC23C=CC4C1(CCC1(C)C(C(C)C/C=C/C(C)(C)OC5OC(CO)C(O)C(O)C5O)CCC41C)C2CCC(OC1OC(CO)C(O)C(O)C1O)C3(C)C |
| InChI | InChI=1S/C43H70O14/c1-22(10-9-15-38(2,3)56-36-34(51)32(49)30(47)25(21-45)54-36)23-13-16-41(7)26-14-17-43-27(42(26,37(52-8)57-43)19-18-40(23,41)6)11-12-28(39(43,4)5)55-35-33(50)31(48)29(46)24(20-44)53-35/h9,14-15,17,22-37,44-51H,10-13,16,18-21H2,1-8H3/b15-9+ |
| InChIKey | NKVQKVICRWILPJ-OQLLNIDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goyaglycoside g (CHEBI:184818) is a cucurbitacin (CHEBI:16219) |
| Goyaglycoside g (CHEBI:184818) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-6-[[19-methoxy-5,9,17,17-tetramethyl-8-[(E)-6-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-4-en-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-16-yl]oxy]oxane-3,4,5-triol |
| Manual Xrefs | Databases |
|---|---|
| 74886468 | ChemSpider |
| HMDB0038350 | HMDB |