EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H108O8 |
| Net Charge | 0 |
| Average Mass | 957.516 |
| Monoisotopic Mass | 956.80442 |
| SMILES | [H][C@]1([C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC)OC[C@H](O)[C@H]1OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C60H108O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-56(62)65-53-55(67-57(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60-59(54(61)52-66-60)68-58(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30,54-55,59-61H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27-/t54-,55+,59+,60+/m0/s1 |
| InChIKey | PRXRUNOAOLTIEF-ADSICKODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sorbitan trioleate (CHEBI:184756) is a carbonyl compound (CHEBI:36586) |
| Sorbitan trioleate (CHEBI:184756) is a organic molecular entity (CHEBI:50860) |
| Sorbitan trioleate (CHEBI:184756) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| [(2R)-2-[(2R,3R,4S)-4-hydroxy-3-[(Z)-octadec-9-enoyl]oxyoxolan-2-yl]-2-[(Z)-octadec-9-enoyl]oxyethyl] (Z)-octadec-9-enoate |
| INNs | Source |
|---|---|
| trioleate de sorbitan | WHO MedNet |
| trioleato de sorbitan | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anhydrosorbitol trioleate | ChEMBL |
| Sorbitan, tri-9-octadecenoate | ChEMBL |
| Sorbitan trioleate | ChEMBL |
| Span-85 | ChEMBL |
| Span85 | ChEMBL |
| Brand Names | Source |
|---|---|
| Arlacel 85 | ChEMBL |
| Sorbitan trioleate component of mf59 span85 | ChEMBL |
| Span 85 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 8095980 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:26266-58-0 | ChemIDplus |