EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO3 |
| Net Charge | 0 |
| Average Mass | 199.250 |
| Monoisotopic Mass | 199.12084 |
| SMILES | CCCCC/C=C/C(=O)C(N)C(=O)O |
| InChI | InChI=1S/C10H17NO3/c1-2-3-4-5-6-7-8(12)9(11)10(13)14/h6-7,9H,2-5,11H2,1H3,(H,13,14)/b7-6+ |
| InChIKey | HNXMRPDBOJFZES-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-octenoylglycine (CHEBI:184713) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (E)-2-amino-3-oxodec-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849710 | ChemSpider |