EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO4 |
| Net Charge | 0 |
| Average Mass | 155.109 |
| Monoisotopic Mass | 155.02186 |
| SMILES | O=C(O)c1cc(O)nc(=O)c1 |
| InChI | InChI=1S/C6H5NO4/c8-4-1-3(6(10)11)2-5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9) |
| InChIKey | CSGQJHQYWJLPKY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CITRAZINIC ACID (CHEBI:184700) is a aromatic carboxylic acid (CHEBI:33859) |
| CITRAZINIC ACID (CHEBI:184700) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-hydroxy-6-oxo-1H-pyridine-4-carboxylic acid |