EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42F2O4 |
| Net Charge | 0 |
| Average Mass | 456.614 |
| Monoisotopic Mass | 456.30512 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(F)(F)C(C)(O)CO)[C@@]1(C)CCC/C2=C\C=C1C[C@@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C26H42F2O4/c1-17(10-12-26(27,28)25(3,32)16-29)22-8-9-23-19(5-4-11-24(22,23)2)7-6-18-13-20(30)15-21(31)14-18/h6-7,17,20-23,29-32H,4-5,8-16H2,1-3H3/b19-7+/t17-,20-,21-,22-,23+,24-,25?/m1/s1 |
| InChIKey | NVLXCHQJLPXKLB-AKYQOPFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24,24-Difluoro-1,25,26-trihydroxyvitamin D3 (CHEBI:184671) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-5,5-diluoro-6,7-dihydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 24823374 | ChemSpider |
| LMST03020647 | LIPID MAPS |