EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42N2O7S |
| Net Charge | 0 |
| Average Mass | 514.685 |
| Monoisotopic Mass | 514.27127 |
| SMILES | CCCCC[C@H](O)[C@@H](/C=C/[C@@H](O)C/C=C\C/C=C\CCCC(=O)O)SC[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C25H42N2O7S/c1-2-3-9-13-21(29)22(35-18-20(26)25(34)27-17-24(32)33)16-15-19(28)12-10-7-5-4-6-8-11-14-23(30)31/h4,6-7,10,15-16,19-22,28-29H,2-3,5,8-9,11-14,17-18,26H2,1H3,(H,27,34)(H,30,31)(H,32,33)/b6-4-,10-7-,16-15+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | PPVZAWNVARPNML-FSHNSKAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14,15-HxA3-D(11S) (CHEBI:184610) is a hydroxy fatty acid (CHEBI:24654) |
| 14,15-HxA3-D(11S) (CHEBI:184610) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (5Z,8Z,11S,12E,14R,15S)-14-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulanyl-11,15-dihydroxyicosa-5,8,12-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369450 | ChemSpider |
| LMFA03090009 | LIPID MAPS |