EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4 |
| Net Charge | 0 |
| Average Mass | 118.088 |
| Monoisotopic Mass | 118.02661 |
| SMILES | COC(=O)CC(=O)O |
| InChI | InChI=1S/C4H6O4/c1-8-4(7)2-3(5)6/h2H2,1H3,(H,5,6) |
| InChIKey | PBVZQAXFSQKDKK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methoxy-3-oxopropanoic acid (CHEBI:184595) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 3-methoxy-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 468836 | ChemSpider |
| HMDB0130020 | HMDB |