EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H32O24 |
| Net Charge | 0 |
| Average Mass | 812.595 |
| Monoisotopic Mass | 812.12835 |
| SMILES | O=C(OC1OC(CO)C(OC(=O)c2cc(O)c(O)c(O)c2)C(O)C1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C33H32O24/c34-7-17-25(54-29(49)8-1-11(35)18(40)12(36)2-8)24(46)27(55-30(50)9-3-13(37)19(41)14(38)4-9)33(53-17)57-31(51)10-5-15(39)20(42)16(6-10)52-32-23(45)21(43)22(44)26(56-32)28(47)48/h1-6,17,21-27,32-46H,7H2,(H,47,48) |
| InChIKey | NNLQIXGUZALYSA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[2,3-dihydroxy-5-({[4-hydroxy-6-(hydroxymethyl)-3,5-bis(3,4,5-trihydroxybenzoyloxy)oxan-2-yl]oxy}carbonyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:184541) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-[2,3-dihydroxy-5-[4-hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]oxycarbonylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0134176 | HMDB |