EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11N3O4 |
| Net Charge | 0 |
| Average Mass | 177.160 |
| Monoisotopic Mass | 177.07496 |
| SMILES | NC(=O)NOCCC(N)C(=O)O |
| InChI | InChI=1S/C5H11N3O4/c6-3(4(9)10)1-2-12-8-5(7)11/h3H,1-2,6H2,(H,9,10)(H3,7,8,11) |
| InChIKey | SFYVZOSIAIZWQU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-4-{[(C-hydroxycarbonimidoyl)amino]oxy}butanoic acid (CHEBI:184529) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-4-(carbamoylamino)oxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012271 | HMDB |
| 19993690 | ChemSpider |