EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | COc1ccc(C(=O)O)c(O)c1OC |
| InChI | InChI=1S/C9H10O5/c1-13-6-4-3-5(9(11)12)7(10)8(6)14-2/h3-4,10H,1-2H3,(H,11,12) |
| InChIKey | CJFQIVAOBBTJCI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-HYDROXY-3,4-DIMETHOXYBENZOIC ACID (CHEBI:184501) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2-hydroxy-3,4-dimethoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 72036 | ChemSpider |
| HMDB0142084 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:5653-46-3 | ChemIDplus |