EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O3 |
| Net Charge | 0 |
| Average Mass | 170.208 |
| Monoisotopic Mass | 170.09429 |
| SMILES | C[C@H](/C=C/C=C/C(=O)O)CCO |
| InChI | InChI=1S/C9H14O3/c1-8(6-7-10)4-2-3-5-9(11)12/h2-5,8,10H,6-7H2,1H3,(H,11,12)/b4-2+,5-3+/t8-/m1/s1 |
| InChIKey | KFHQGKGXRZPBOB-YFIBRCQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dendryphiellic acid B (CHEBI:184454) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6S)-8-hydroxy-6-methylocta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 75148750 | ChemSpider |
| LMFA01020399 | LIPID MAPS |