EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O2 |
| Net Charge | 0 |
| Average Mass | 126.155 |
| Monoisotopic Mass | 126.06808 |
| SMILES | C=C/C(C)=C\CC(=O)O |
| InChI | InChI=1S/C7H10O2/c1-3-6(2)4-5-7(8)9/h3-4H,1,5H2,2H3,(H,8,9)/b6-4- |
| InChIKey | BFUYPWNVMSXEQU-XQRVVYSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Methyl-3Z,5-hexadienoic acid (CHEBI:184434) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (3Z)-4-methylhexa-3,5-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9280508 | ChemSpider |
| LMFA01030792 | LIPID MAPS |