EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14N2O |
| Net Charge | 0 |
| Average Mass | 118.180 |
| Monoisotopic Mass | 118.11061 |
| SMILES | NCCC(O)CCN |
| InChI | InChI=1S/C5H14N2O/c6-3-1-5(8)2-4-7/h5,8H,1-4,6-7H2 |
| InChIKey | DCPSTLZVUJTDTC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxycadaverine (CHEBI:184422) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| 1,5-diaminopentan-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 384956 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:38595-00-5 | ChemIDplus |