EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4NO4S.K |
| Net Charge | 0 |
| Average Mass | 201.244 |
| Monoisotopic Mass | 200.94981 |
| SMILES | CC1=CC(=O)[N-]S(=O)(=O)O1.[K+] |
| InChI | InChI=1S/C4H5NO4S.K/c1-3-2-4(6)5-10(7,8)9-3;/h2H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | WBZFUFAFFUEMEI-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acesulfame k (CHEBI:184415) has role laxative (CHEBI:50503) |
| Acesulfame k (CHEBI:184415) is a sulfuric acid derivative (CHEBI:37826) |
| IUPAC Name |
|---|
| potassium;6-methyl-2,2-dioxo-1-oxa-2lambda6-thia-3-azanidacyclohex-5-en-4-one |
| Synonyms | Source |
|---|---|
| Acesulfame k | ChEMBL |
| acesulfame potassium | ChEMBL |
| Acesulfame potassium | ChEMBL |
| Acesulfame potassium salt | ChEMBL |
| E 950 | ChEMBL |
| E-950 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:55589-62-3 | ChemIDplus |
| Citations |
|---|