EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | COc1cc(CC(=O)C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C10H10O6/c1-16-9-3-5(2-8(13)10(14)15)6(11)4-7(9)12/h3-4,11-12H,2H2,1H3,(H,14,15) |
| InChIKey | JZXZFMNTVLBNJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,4-dihydroxy-5-methoxyphenyl)-2-oxopropanoic acid (CHEBI:184410) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(2,4-dihydroxy-5-methoxyphenyl)-2-oxopropanoic acid (CHEBI:184410) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxy-5-methoxyphenyl)-2-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 102111977 | ChemSpider |