EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | Nc1c(O)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C7H7NO4/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2,9-10H,8H2,(H,11,12) |
| InChIKey | GBAYSGRTRJSJIK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (28465627) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-2,4-dihydroxybenzoic acid (CHEBI:184386) has role bacterial metabolite (CHEBI:76969) |
| 3-amino-2,4-dihydroxybenzoic acid (CHEBI:184386) is a aminobenzoic acid (CHEBI:22495) |
| 3-amino-2,4-dihydroxybenzoic acid (CHEBI:184386) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3-amino-2,4-dihydroxybenzoic acid (CHEBI:184386) is conjugate acid of 3-amino-2,4-dihydroxybenzoate (CHEBI:180657) |
| Incoming Relation(s) |
| 3-amino-2,4-dihydroxybenzoate (CHEBI:180657) is conjugate base of 3-amino-2,4-dihydroxybenzoic acid (CHEBI:184386) |
| IUPAC Name |
|---|
| 3-amino-2,4-dihydroxybenzoic acid |
| Synonym | Source |
|---|---|
| 2,4-dihydroxy-3-aminobenzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 25937024 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:860505-23-3 | ChEBI |
| Citations |
|---|