EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:184373 - cremeomycin
| Formula | C8H6N2O4 |
| Net Charge | 0 |
| Average Mass | 194.146 |
| Monoisotopic Mass | 194.03276 |
| SMILES | COC1=CC=C(C(=O)O)C(=O)C1=[N+]=[N-] |
| InChI | InChI=1S/C8H6N2O4/c1-14-5-3-2-4(8(12)13)7(11)6(5)10-9/h2-3H,1H3,(H,12,13) |
| InChIKey | HTCPEWKHGGGJBI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces cremeus (ncbitaxon:66881) | - | PubMed (7622439) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cremeomycin (CHEBI:184373) has role antibacterial agent (CHEBI:33282) |
| cremeomycin (CHEBI:184373) has role antineoplastic agent (CHEBI:35610) |
| cremeomycin (CHEBI:184373) has role bacterial metabolite (CHEBI:76969) |
| cremeomycin (CHEBI:184373) is a cyclohexadiene (CHEBI:37613) |
| cremeomycin (CHEBI:184373) is a diazo compound (CHEBI:39444) |
| cremeomycin (CHEBI:184373) is a ether (CHEBI:25698) |
| cremeomycin (CHEBI:184373) is a monocarboxylic acid (CHEBI:25384) |
| cremeomycin (CHEBI:184373) is conjugate acid of cremeomycin(1−) (CHEBI:180678) |
| Incoming Relation(s) |
| cremeomycin(1−) (CHEBI:180678) is conjugate base of cremeomycin (CHEBI:184373) |
| IUPAC Name |
|---|
| 5-diazo-4-methoxy-6-oxocyclohexa-1,3-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-diazo-4-methoxy-6-oxo-1,3-cyclohexadiene-1-carboxylic acid | ChEBI |
| U 23643 | ChEBI |
| antibiotic U 23643 | ChEBI |
| U-23,643 | ChEBI |
| U-23643 | ChEBI |
| Citations |
|---|