EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | CCCCC[C@@H]1C(=O)CC[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h9-10H,2-8H2,1H3,(H,14,15)/t9-,10-/m0/s1 |
| InChIKey | PQEYTAGBXNEUQL-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-9,10-dihydrojasmonic acid (CHEBI:18436) is a dihydrojasmonic acid (CHEBI:23747) |
| (+)-9,10-dihydrojasmonic acid (CHEBI:18436) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| [(1S,2S)-3-oxo-2-pentylcyclopentyl]acetic acid |
| Synonym | Source |
|---|---|
| (+)-dihydrojasmonic acid | ChEBI |