EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)C(O)/C=C/C=C/C=C\C=C\[C@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-21,23-25H,2,13,15-16,18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,11-8-,14-10+,17-12+/t19-,20-,21?/m0/s1 |
| InChIKey | IKFAUGXNBOBQDM-GIINMYNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | |||
| spermatozoon (FMA:67338) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] | |
| spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,7R,8E,10Z,12E,14E,17S,19Z)-7,16,17-Trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid (CHEBI:184332) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (4Z,7R,8E,10Z,12E,14E,17S,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17216185 | ChemSpider |
| HMDB0002294 | HMDB |
| LMFA04000007 | LIPID MAPS |