EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H23NO19 |
| Net Charge | 0 |
| Average Mass | 689.491 |
| Monoisotopic Mass | 689.08643 |
| SMILES | O=C(O)C/N=C(\O)c1c(-c2c(O)c(O)c(O)c3cc(C(O)C(O)C(O)CO)oc(=O)c23)c(O)c(O)c2oc(=O)c3cc(O)c(O)c(O)c3c12 |
| InChI | InChI=1S/C29H23NO19/c31-4-8(33)19(38)20(39)9-2-5-12(29(47)48-9)13(22(41)24(43)17(5)36)14-16(27(45)30-3-10(34)35)15-11-6(1-7(32)18(37)21(11)40)28(46)49-26(15)25(44)23(14)42/h1-2,8,19-20,31-33,36-44H,3-4H2,(H,30,45)(H,34,35) |
| InChIKey | OOWQTALUGSKLJV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | |||
| spermatozoon (FMA:67338) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] | |
| spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy({3,4,8,9,10-pentahydroxy-6-oxo-2-[5,6,7-trihydroxy-1-oxo-3-(1,2,3,4-tetrahydroxybutyl)-1H-isochromen-8-yl]-6H-benzo[c]chromen-1-yl})methylidene]amino}acetic acid (CHEBI:184321) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 2-[[hydroxy-[3,4,8,9,10-pentahydroxy-6-oxo-2-[5,6,7-trihydroxy-1-oxo-3-(1,2,3,4-tetrahydroxybutyl)isochromen-8-yl]benzo[c]chromen-1-yl]methylidene]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0129902 | HMDB |