EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N3O4 |
| Net Charge | 0 |
| Average Mass | 233.268 |
| Monoisotopic Mass | 233.13756 |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C9H19N3O4/c10-4-2-1-3-6(11)8(14)12-7(5-13)9(15)16/h6-7,13H,1-5,10-11H2,(H,12,14)(H,15,16) |
| InChIKey | YSZNURNVYFUEHC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | |||
| spermatozoon (FMA:67338) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] | |
| spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein-Friesian cattle [26105007] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2,6-Diamino-1-hydroxyhexylidene)amino]-3-hydroxypropanoic acid (CHEBI:184317) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-(2,6-diaminohexanoylamino)-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9358975 | ChemSpider |
| HMDB0028960 | HMDB |