EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@]3(O)C[C@@H](O)C[C@@H](O)[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H30O5/c1-17-6-5-13-11(12(17)3-4-14(17)21)8-16(23)19(24)9-10(20)7-15(22)18(13,19)2/h10-13,15-16,20,22-24H,3-9H2,1-2H3/t10-,11-,12-,13-,15+,16+,17-,18-,19-/m0/s1 |
| InChIKey | ONHQGXIEYFYVDF-MESRZZFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1beta,3beta,5alpha,6beta-tetrahydroxyandrostan-17-one (CHEBI:184287) has role androgen (CHEBI:50113) |
| 1beta,3beta,5alpha,6beta-tetrahydroxyandrostan-17-one (CHEBI:184287) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (1R,3S,5R,6R,8R,9S,10S,13S,14S)-1,3,5,6-tetrahydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| Manual Xrefs | Databases |
|---|---|
| 128906 | ChemSpider |
| LMST02020108 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:90134-60-4 | ChemIDplus |