EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CC(CSCCN)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-5(6(8)9)4-10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | UFRVABODKAYFCB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(2-carboxypropyl)-Cysteamine (CHEBI:184285) is a amino acid (CHEBI:33709) |
| IUPAC Name |
|---|
| 3-(2-aminoethylsulanyl)-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002169 | HMDB |
| LMFA01020395 | LIPID MAPS |
| 117681 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:80186-81-8 | ChemIDplus |