EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | N[C@@H](CCCC1OCCO1)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c9-6(8(10)11)2-1-3-7-12-4-5-13-7/h6-7H,1-5,9H2,(H,10,11)/t6-/m0/s1 |
| InChIKey | RQULWPSGQYZREI-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Allysine Ethylene Acetal (CHEBI:184275) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-(1,3-dioxolan-2-yl)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9216692 | ChemSpider |