EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | CCCCCc1oc(CCCCC(=O)O)c(C)c1C |
| InChI | InChI=1S/C16H26O3/c1-4-5-6-9-14-12(2)13(3)15(19-14)10-7-8-11-16(17)18/h4-11H2,1-3H3,(H,17,18) |
| InChIKey | IVHFOCAFZRRFIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-Dimethyl-5-pentyl-2-furanpentanoic acid (CHEBI:184235) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 5-(3,4-dimethyl-5-pentyluran-2-yl)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849741 | ChemSpider |
| HMDB0112085 | HMDB |
| LMFA01150024 | LIPID MAPS |