EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | CC(C)=CCc1cc(CC(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H18O4/c1-9(2)3-5-11-7-10(4-6-12(11)15)8-13(16)14(17)18/h3-4,6-7,13,15-16H,5,8H2,1-2H3,(H,17,18) |
| InChIKey | DGQIBZIHFKWHCR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]propanoic acid (CHEBI:184204) is a benzenes (CHEBI:22712) |
| 2-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]propanoic acid (CHEBI:184204) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133182 | HMDB |
| 74853206 | ChemSpider |