EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O4 |
| Net Charge | 0 |
| Average Mass | 300.314 |
| Monoisotopic Mass | 300.11101 |
| SMILES | CC(CNc1ccc([N+](=O)[O-])cc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O4/c1-11(12-5-3-2-4-6-12)10-17-15-8-7-13(18(21)22)9-14(15)16(19)20/h2-9,11,17H,10H2,1H3,(H,19,20) |
| InChIKey | AUOOMXDMBHRLSI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-NITRO-2-PHENYLPROPYLAMINOBENZOIC ACID (CHEBI:184197) is a nitrobenzoic acid (CHEBI:25553) |
| IUPAC Name |
|---|
| 5-nitro-2-(2-phenylpropylamino)benzoic acid |