EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33N3O7S |
| Net Charge | 0 |
| Average Mass | 531.631 |
| Monoisotopic Mass | 531.20392 |
| SMILES | NC(CCC(=O)NC(CSC(CO)(CCc1ccccc1)c1ccccc1)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H33N3O7S/c27-20(25(35)36)11-12-22(31)29-21(24(34)28-15-23(32)33)16-37-26(17-30,19-9-5-2-6-10-19)14-13-18-7-3-1-4-8-18/h1-10,20-21,30H,11-17,27H2,(H,28,34)(H,29,31)(H,32,33)(H,35,36) |
| InChIKey | ZAUNDIWOHLSQHC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | serum (BTO:0001239) | MetaboLights (MTBLS3725) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-[(1-hydroxy-2,4-diphenylbutan-2-yl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:184146) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-(1-hydroxy-2,4-diphenylbutan-2-yl)sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0135577 | HMDB |