EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | CC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
| InChIKey | SULYEHHGGXARJS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',4'-dihydroxyacetophenone (CHEBI:18414) has role plant metabolite (CHEBI:76924) |
| 2',4'-dihydroxyacetophenone (CHEBI:18414) is a dihydroxyacetophenone (CHEBI:23776) |
| 2',4'-dihydroxyacetophenone (CHEBI:18414) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 1-(2,4-dihydroxyphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 2',4'-Dihydroxyacetophenone | KEGG COMPOUND |
| 2,4-Dihydroxyacetophenone | KEGG COMPOUND |
| Resacetophenone | KEGG COMPOUND |
| 4-Acetylresorcinol | ChemIDplus |