EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O4 |
| Net Charge | 0 |
| Average Mass | 380.444 |
| Monoisotopic Mass | 380.17361 |
| SMILES | O=C(/C=C\c1ccc(O)cc1)NCCCCNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c25-19-9-3-17(4-10-19)7-13-21(27)23-15-1-2-16-24-22(28)14-8-18-5-11-20(26)12-6-18/h3-14,25-26H,1-2,15-16H2,(H,23,27)(H,24,28)/b13-7-,14-8+ |
| InChIKey | PYVBFDCHJDMSMM-MFUUIURDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (z)-3-(4-hydroxyphenyl)-n-[4-[[(e)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]prop-2-enamide (CHEBI:184116) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (Z)-3-(4-hydroxyphenyl)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 29814309 | ChemSpider |