EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N6O6 |
| Net Charge | 0 |
| Average Mass | 448.480 |
| Monoisotopic Mass | 448.20703 |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C20H28N6O6/c21-20(22)23-9-1-2-14(19(31)32)25-18(30)15(10-11-3-5-12(27)6-4-11)26-17(29)13-7-8-16(28)24-13/h3-6,13-15,27H,1-2,7-10H2,(H,24,28)(H,25,30)(H,26,29)(H,31,32)(H4,21,22,23) |
| InChIKey | PBAJTYIXHQQLKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-tyr-arg (CHEBI:184100) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 5-(diaminomethylideneamino)-2-[[3-(4-hydroxyphenyl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]amino]pentanoic acid |