EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:184099 - Pyroglu-trp-lys
| Formula | C22H29N5O5 |
| Net Charge | 0 |
| Average Mass | 443.504 |
| Monoisotopic Mass | 443.21687 |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc2ccccc12)NC(=O)C1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C22H29N5O5/c23-10-4-3-7-17(22(31)32)26-21(30)18(27-20(29)16-8-9-19(28)25-16)11-13-12-24-15-6-2-1-5-14(13)15/h1-2,5-6,12,16-18,24H,3-4,7-11,23H2,(H,25,28)(H,26,30)(H,27,29)(H,31,32) |
| InChIKey | GMGGWUMZJHUWKG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-trp-lys (CHEBI:184099) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 6-amino-2-[[3-(1H-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]amino]hexanoic acid |