EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N4O5 |
| Net Charge | 0 |
| Average Mass | 404.467 |
| Monoisotopic Mass | 404.20597 |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C20H28N4O5/c21-11-5-4-8-15(20(28)29)23-19(27)16(12-13-6-2-1-3-7-13)24-18(26)14-9-10-17(25)22-14/h1-3,6-7,14-16H,4-5,8-12,21H2,(H,22,25)(H,23,27)(H,24,26)(H,28,29) |
| InChIKey | KZFDRSALOYPRBE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-phe-lys (CHEBI:184098) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 6-amino-2-[[2-[(5-oxopyrrolidine-2-carbonyl)amino]-3-phenylpropanoyl]amino]hexanoic acid |