EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O6 |
| Net Charge | 0 |
| Average Mass | 244.203 |
| Monoisotopic Mass | 244.06954 |
| SMILES | O=C(O)CC(NC(=O)C1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C9H12N2O6/c12-6-2-1-4(10-6)8(15)11-5(9(16)17)3-7(13)14/h4-5H,1-3H2,(H,10,12)(H,11,15)(H,13,14)(H,16,17) |
| InChIKey | LQDZJEZNUDFDNE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroglu-Asp (CHEBI:184096) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(5-oxopyrrolidine-2-carbonyl)amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 32131076 | ChemSpider |