EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N2O7 |
| Net Charge | 0 |
| Average Mass | 542.673 |
| Monoisotopic Mass | 542.29920 |
| SMILES | [H][C@@]12C[C@@]3([H])C45C(OC)CC[C@@]6(OC(=O)c7ccccc7N)CN(CC)C4C(C[C@@]56[H])[C@@](O)(C[C@@H]1OC)[C@@]3(O)[C@H]2OC |
| InChI | InChI=1S/C30H42N2O7/c1-5-32-15-27(39-26(33)16-8-6-7-9-19(16)31)11-10-23(37-3)29-21(27)13-18(24(29)32)28(34)14-20(36-2)17-12-22(29)30(28,35)25(17)38-4/h6-9,17-18,20-25,34-35H,5,10-15,31H2,1-4H3/t17-,18?,20+,21-,22+,23?,24?,25+,27-,28+,29?,30+/m1/s1 |
| InChIKey | VSUODASNSRJNCP-BXUVZERWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Puberanidine (CHEBI:184092) has functional parent aconitane (CHEBI:35911) |
| Puberanidine (CHEBI:184092) is a diterpene alkaloid (CHEBI:23847) |
| IUPAC Name |
|---|
| [(2S,3S,4S,5R,6S,8S,13S,16S,17S)-11-ethyl-3,8-dihydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl] 2-aminobenzoate |
| Manual Xrefs | Databases |
|---|---|
| 21250823 | ChemSpider |