EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H56N4O9 |
| Net Charge | 0 |
| Average Mass | 796.962 |
| Monoisotopic Mass | 796.40473 |
| SMILES | [H][C@]12CN(CCc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N[C@]3([H])[C@@]45CCN4CC=C[C@@](CC)([C@@H](OC(C)=O)[C@@]3(O)OC(C)=O)[C@]45[H])C1)C[C@](O)(CC)C2 |
| InChI | InChI=1S/C45H56N4O9/c1-7-41(53)22-28-23-44(40(52)56-6,36-30(14-18-48(24-28)25-41)29-12-9-10-13-33(29)46-36)32-20-31-34(21-35(32)55-5)47-37-43(31)16-19-49-17-11-15-42(8-2,38(43)49)39(57-26(3)50)45(37,54)58-27(4)51/h9-13,15,20-21,28,37-39,46-47,53-54H,7-8,14,16-19,22-25H2,1-6H3/t28-,37-,38+,39-,41+,42-,43-,44+,45+/m1/s1 |
| InChIKey | UKTHEPLAUBGZND-JVXAYHPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylamphetamine (CHEBI:184079) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-(1-phenylpropan-2-yl)ormamide |
| Manual Xrefs | Databases |
|---|---|
| 59055 | ChemSpider |