EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | O=C(NO)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H7NO4/c9-5-2-1-4(3-6(5)10)7(11)8-12/h1-3,9-10,12H,(H,8,11) |
| InChIKey | QJMCKEPOKRERLN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-3,4-tridhydroxybenzamide (CHEBI:184074) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| N,3,4-trihydroxybenzamide |