EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26N2O3 |
| Net Charge | 0 |
| Average Mass | 258.362 |
| Monoisotopic Mass | 258.19434 |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-8(2)6-10(14)12(16)15-11(7-9(3)4)13(17)18-5/h8-11H,6-7,14H2,1-5H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | AJMOLNFDYWTVQW-QWRGUYRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-leucyl-l-leucine methyl ester (CHEBI:184067) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 5379885 | ChemSpider |