EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N2O6S |
| Net Charge | 0 |
| Average Mass | 510.697 |
| Monoisotopic Mass | 510.27636 |
| SMILES | CCCCC/C=C\C/C=C\C=C/C=C\C(SCC(N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C26H42N2O6S/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-23(22(29)16-15-18-25(32)34-2)35-20-21(27)26(33)28-19-24(30)31/h7-8,10-14,17,21-23,29H,3-6,9,15-16,18-20,27H2,1-2H3,(H,28,33)(H,30,31)/b8-7-,11-10-,13-12-,17-14-/t21?,22-,23?/m0/s1 |
| InChIKey | PVGJCQKBOXAJIF-YIWIDSIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leukotriene d4 methyl ester (CHEBI:184064) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[2-amino-3-[(5S,7Z,9Z,11Z,14Z)-5-hydroxy-1-methoxy-1-oxoicosa-7,9,11,14-tetraen-6-yl]sulanylpropanoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 21467579 | ChemSpider |